PHYSICS HIGH SCHOOL

________ reaction time involves selecting a specific and correct response from several choices when presented with several different stimuli.a. Complex
b. Standard
c. Simple
d. Visual

Answers

Answer 1
Answer: Simple reaction time involves selecting aspecific and correct response from several choices when presented with severaldifferent stimuli. This is very important because historically, this was thefirst indicators of intelligence pioneered by Francis Galton. To measure one’sintelligence is to know how he quick a person could respond to the stimuluswith an already expected response wherein the stimulus is given unknown to thereceiver. In other terms, the intelligence is measured on how quick a personcould grasp certain concepts and how he could think fast and answer themcorrectly. 
Answer 2
Answer: Complex reaction time involves selecting a specific and correct response from several choices when presented with several different stimuli.
Answer: A

Related Questions

Assume you have 3 light bulbs connected in a series circuit to a battery.What can you say about the current through each light bulb? Current varies through all bulbs There is no current through the bulbs Current is the same through all bulbs
The best evidence of Earths rotation is provided by
A low-pressure system is generally associated with what type of weather condition?A.thick cloud cover B.increasing altitude C.low humidity D.clear sky
How strongly the planet you're on pulls on you is your
An event occurs in system K’ at x’ = 2 m, y’ = 3.5 m, z’= 3.5 m, and t’= 0. System K’ and K have their axes coincident at t = t’= 0, and system K’ travels along the x axis of system K with a speed 0.8c. What are the coordinates of the event in system K?

In a sound wave, the magnitude of the compression is ___ the magnitude of the rarefaction. greater than
less than
equal to

Answers

At first, I thought it depends on the waveform of the sound ... sine wave,
square wave, sawtooth wave, complex wave, etc.   But the magnitude of
the compression must be equal to the magnitude of the rarefaction.  It
it weren't, then air molecules would creep along the wave in the direction
of one or the other, and the wave would carry matter as well as energy ...
and we know that waves don't do that.

In a sound wave, the magnitude of the compression is ___ the magnitude of the rarefaction.

equal to

NEED ASAP PLEASE !! Billy drops a water balloon from the roof of his house. Since the balloon began with an original velocity of zero, how far above ground was the balloon dropped if it took 2.5 seconds to hit the ground?

A. 30.6 m
B. 122.5 m
C. 12.3 m
D. 49.0 m

Answers

The formula you want is:

           Distance = (1/2) (gravity) (time)²

                           =  (1/2) (9.8 m/s²) (2.5 sec)²

                           =    (4.9 m/s²)  (6.25 sec²)

                           =            30.6 meters

Choose the correct statement. A. Turning the steering wheel rotates the pinion and moves the rack up and down
B. The teeth on both the pinion and the rack are helical gears
C. A large pinion means the number of turns of the steering wheel is increased
D. The steering ratio is the same on all vehicles

Answers

The answer would be C

The formula for degrees Celsius is: C = 5/9 (F − 32), where F stands for degrees Fahrenheit.Part 1: Solve the equation for F and show all steps.
Part 2: Determine how many degrees Fahrenheit 20 degrees Celsius is.

Answers

C = 5/9 (F-32)Part 1.  C=5F/9-(5/9)325F/9=C+160/9F=(9/5)C+(9/5)(160/9)F=(9/5)C+32for part 2:
F=(9/5)20+32F=36+32=68 degrees Fahrenheit

How to covert ma into amphere?

Answers

1 ampere = 1,000 milliamperes

1 A = 1,000 mA

To calculate the number of Amperes, divide the number of milliamperes by 1,000.

What is acceleration due to gravity

Answers

If you stay on the same planet and drop a lot of objects one at a time,
it turns out that every object you drop falls from your hand to the ground
with the same acceleration, and hits the ground with the same speed,
no matter whether the object is light, heavy, or anything in between.

That particular value of acceleration is the "acceleration due to gravity".
On Earth, it's 9.81 meters per second².  On the moon, it's 1.62 meters
per second².  On Jupiter, it's 25.89 meters per second².

Why we don't generally notice it:  The previous description is true if the
ONLY force on the object is the force of gravity.  If it has to fall through
air on the way down, then the air can have a great effect on it.  Many
museums have an exhibit where they drop things in a long tube with
all the air removed from it, and there you can see some pretty weird
stuff ... like a bowling ball, a rock, a sheet of paper, and a feather, all
falling together, with nothing fluttering.

Why everything falls with the same acceleration ?  That's a separate question.
The acceleration developed between two bodies containing mass as a result of the gravitational force between them.
Other Questions
What volume will a sample of copper 98.2 g occupy? the density of copper is 8.96 g/mL
What would happen if the world stopped spinning? would everyone fly forword or what would happen
A silver bar 0.125 meter long is subjected to a temperature change from 200°C to 100°C. What will be the length of the bar after the temperature change? A. 0.0000189 meterB. 0.00002363 meterC. 0.124764 meterD. 0.00023635 meter
_________ constancy refers to the ability to understand that an object retains the same lightness even when illuminated differently.a. Color b. Shape c. Brightness d. Weight