PHYSICS COLLEGE

How does simple machines make work easier?

Answers

Answer 1

Answer: They make it so you would exert less force and make things easier to move

Answer 2

Answer:

The simple machines can help make work easier by working quicker than the people and making other peoples jobs easier.

Explanation:

I hope this helped.

Related Questions

For the system shown below, what is the critical angle (angle at which the system just begins to move)? Assume that the coefficient of friction between all flat surfaces is 0.0500 and that the pulley is frictionless. The mass of m1 is 76.00 kg and the mass of m2 is 194.00 kg. Express your answer in radians.
In an evironmental system of subsystem, the mass balance equation is:__________.
In a game of tug of war, a rope is pulled by a force of 182 N to the right and by a force of 108 N to the left. Calculate the magnitude and direction of the net horizontal force on the rope.
The International Space Station (ISS) is a space station orbiting the earth above the ground. If the radius of the earth is 3,958.8 miles, mass of earth is 5.972 x 10 24 kg, the period of the ISS at the orbit around the earth is 7.84 hours, can you calculate what is the distance from the ISS to the surface of the earth, in unit of miles
What was the main idea of Malthus theory of population

The uniform crate has a mass of 50 kg and rests on the cart having an inclined surface. Determine the smallest acceleration that will cause the crate either to tip or slip relative to the cart. What is the magnitude of this acceleration

Answers

Answer:

The answer is below

Explanation:

Let g = acceleration due to gravity = 9.81 m/s², x = half of the width of the crate, half of the height of the crate = 0.5 m, a = acceleration of crate, N = force raising the crate

The sum of moment is given as:

$50asin(15)x+50acos(15)0.5=-50(9.81)sin(15)0.5+50(9.81)cos(15)x\ \ \ (1)$

Sum of vertical forces is zero, hence:

$N-50(9.81)cos(15)+50acos(15)=0\ \ \ (2)$

Sum of horizontal force is zero, hence:

$50(9.81)sin(15)-\mu N+50acos(15)=0\n\n50(9.81)sin(15)-0.5 N+50acos(15)=0\ \ \ (3)$

Solving equation 1, 2 and 3 simultaneously gives :

N = 447.8 N, a = 2.01 m/s², x = 0.25 m

x is supposed to be 0.3 m (0.6/2)

The crate would slip because x <0.3 m

How do you define 'heat' and 'temperature'

Answers

Temperature -a measure of the average kinetic energy of the individual particles in an object

Heat is the movement of thermal energy from a substance of higher temperature to a substance of lower temperature

Answer:

Heat and temperature are related but very different.

Explanation:

Heat: The total energy of molecular motion in a substance

Temperature: A measure of the average energy of molecular motion in a substance

For further help:

Examples

Heat Temperature

-Heat is a form of energy that can -The degree of hotness and

transfer from hot body to cold body coldness of the body

-------------------------------------------------------------------------------------------------------------

-Heat flows from hot body to cold -It rises when heated and falls down

body when an object is cooled down

-------------------------------------------------------------------------------------------------------------

-Total kinetic energy and potential -Temp. is the average kinetic

energy obtained by molecules in energy of molecules in a

an object substance

A hemispherical surface (half of a spherical surface) of radius R is located in a uniform electric field of magnitude E that is parallel to the axis of the hemisphere. What is the magnitude of the electric flux through the hemisphere surface?

Answers

Answer:

π*R²*E

Explanation:

According to the definition of electric flux, it can be calculated integrating the product E*dA, across the surface.

As the electric field E is uniform and parallel to the hemisphere axis, and no charge is enclosed within it, the net flux will be zero, so, in magnitude, the flux across the opening defining the hemisphere, must be equal to the one across the surface.

The flux across the open surface can be expressed as follows:

$\int\ {E} \, dA = E*A = E*\pi *R^(2)$

As E is constant, and parallel to the surface vector dA at any point, can be taken out of the integral, which is just the area of the surface, π*R².

⇒Flux = E*π*R²

Consider a space shuttle which has a mass of about 1.0 x 105 kg and circles the Earth at an altitude of about 200.0 km. Calculate the force of gravity that the space shuttle experiences

Answers

Final answer:

The force of gravity that the space shuttle experiences is 9.8 x 10^5 Newtons.

Explanation:

To calculate the force of gravity that the space shuttle experiences, we can use the equation F = mg, where F represents the force of gravity, m is the mass of the object, and g is the acceleration due to gravity (approximately 9.8 m/s² on Earth). In this case, the mass of the space shuttle is given as 1.0 x 10^5 kg. However, we need to convert the altitude of the shuttle into meters, so 200.0 km becomes 200,000 meters.

Now we can calculate the force of gravity:

F = (1.0 x 10^5 kg)(9.8 m/s²)

F = 9.8 x 10^5 N

Therefore, the space shuttle experiences a force of gravity of 9.8 x 10^5 Newtons.

Learn more about force of gravity here:

brainly.com/question/12753714

#SPJ3

Lightning can sometimes occur on hot and humid summer evenings when there are no thunderstorms.(A) True
(B) False

Answers

Answer:

(B) False

Explanation:

No, it is not possible to have thunder without lightning. Thunder is a direct result of lightning.

B False because facts

A string that passes over a pulley has a 0.341 kg mass attached to one end and a 0.625 kg mass attached to the other end. The pulley, which is a disk of radius 9.00 cm , has friction in its axle.What is the magnitude of the frictional torque that must be exerted by the axle if the system is to be in static equilibrium? (Answer should be in N m)