The kinetic energy of all the particles in a given sample of matter is the same.a. True
b. False

Answers

Answer 1

Answer: It's B.
It's never going to be true UNLESS you cooled the entire thing to below zero then it could be true.

Related Questions

How will you join three resistances, each of 2 ohm so that the effective resistance is 3 ohm?
Two objects are dropped from rest from the same height. Object A falls through a distance during a time t, and object B falls through a distance during a time 2t. If air resistance is negligible, what is the relationship between A and B?
A periodic wave is produced by a vibratingtuning fork. The amplitude of the wave would begreater if the tuning fork were(1) struck more softly(2) struck harder(3) replaced by a lower frequency tuning fork(4) replaced by a higher frequency tuning fork
Electromagnetic waves can travel through empty space true or false
Beth has built a simple series circuit using wire, a battery, a lightbulb, and a switch. The bulb, however, does not light up when the switch is closed. Which describes a step that will help troubleshoot and work toward the solution of this problem? A. Reverse the way the wire is connected to the poles of the battery. B. Use an electrical meter to test the voltage of the battery. C. Shorten the length of wire between the battery and the switch. D. Change the wiring scheme to parallel.

Parallel light waves hit the surface of a still lake and reflect in the same direction. Which interaction of light and matter does this illustrate?

Answers

Parallel light waves hit the surface of a still lake and reflect in the same direction and the interaction of light and matter that it illustrates is called regular reflection. Regular reflection occurs whenever the reflecting surface is very smooth. The surface of the still lake is smooth. I hope the answer helps you.

Answer:

regular reflection

Explanation:

Gradpoint

Which of the following is a chemical change?a. ice melting
b. ice being carved
c. water boiling
d. water breaking down into hydrogen and oxygen

Answers

water breaking down into hydrogen and oxygen

Which is best example of s force counteracting Fp?

Answers

Answer:

two children pulling apart a wishbone

Explanation:

The formula for degrees Celsius is: C = 5/9 (F − 32), where F stands for degrees Fahrenheit.Part 1: Solve the equation for F and show all steps.
Part 2: Determine how many degrees Fahrenheit 20 degrees Celsius is.

Answers

C = 5/9 (F-32)Part 1. C=5F/9-(5/9)325F/9=C+160/9F=(9/5)C+(9/5)(160/9)F=(9/5)C+32for part 2:
F=(9/5)20+32F=36+32=68 degrees Fahrenheit

Identify the main renewable energy resources

Answers

The main renewable sources of energy are solar radiation, wind, geothermal, and tides.

The main renewable energy resources are
Tidal energy
Hydroelectric energy
Wind energy
Geothermal energy
Solar energy

A particle with charge − 3.74 × 10 − 6 C is released at rest in a region of constant, uniform electric field. Assume that gravitational effects are negligible. At a time 8.36 s after it is released, the particle has a kinetic energy of 3.17 × 10 − 8 J. At what time t after the particle is released has it traveled through a potential difference of 0.401 V?

Answers

Answer:

57.5022228905 s

Explanation:

$V_i$ = Initial voltage

$V_f$ = Final voltage = 0.401 V

$t_1$ = Initial time = 8.36 s

$t_2$ = Final time

K = Kinetic Energy = $3.18* 10^(-8)\ J$

C = Charge = $3.74* 10^(-6)\ C$

Voltage is given by

$V=(K)/(C)\n\Rightarrow V=(3.17* 10^(-8))/(3.74* 10^(-6))\n\Rightarrow V=0.00847593582888\ V$

We have the relation

$(V_i)/(V_f)=((t_i)/(t_f))^2\n\Rightarrow t_f=\sqrt{(t_i^2V_f)/(V_i)}\n\Rightarrow t_f=\sqrt{(8.36^2* 0.401)/(0.00847593582888)}\n\Rightarrow t_f=57.5022228905\ s$

The time taken is 57.5022228905 s

Final answer:

To find the time after which the particle has traveled through a potential difference of 0.401 V, use the formula KE = q · V and solve for t.

Explanation:

To find the time after which the particle has traveled through a potential difference of 0.401 V, we need to use the relationship between kinetic energy, electric potential difference, and charge. The formula is given by:

KE = q · V

where KE is the kinetic energy, q is the charge, and V is the potential difference. Rearranging the formula, we have:

t = KE / (q · V)

Substituting the given values, we get:

t = (3.17 · 10-8) / ((-3.74 · 10-6) · 0.401)

Solving for t, we find that the particle has traveled through a potential difference of 0.401 V at a time of approximately 2.07 seconds.